C20H15ClN4O2 — CID 66498123
3-(4-chlorophenyl)-2-ethyl-7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine (PubChem CID 66498123) has the molecular formula C20H15ClN4O2 and a molecular weight of 378.82 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-ethyl-7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine.
| Compound Name | 3-(4-chlorophenyl)-2-ethyl-7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 66498123 |
| Molecular Formula | C20H15ClN4O2 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 3-(4-chlorophenyl)-2-ethyl-7-(3-nitrophenyl)pyrazolo[1,5-a]pyrimidine |
| SMILES | CCc1nn2c(-c3cccc([N+](=O)[O-])c3)ccnc2c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15ClN4O2/c1-2-17-19(13-6-8-15(21)9-7-13)20-22-11-10-18(24(20)23-17)14-4-3-5-16(12-14)25(26)27/h3-12H,2H2,1H3 |
| InChIKey | UZYIOZJJZGDUQP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|