C25H28FN3O3 — CID 163382375
ethanimidoyl 4-[2-(1-cyclopropyl-2-hydroxy-2-methylpropyl)-3-oxo-1H-isoindol-4-yl]-3-fluoro-2-methylbenzenecarboximidate (PubChem CID 163382375) has the molecular formula C25H28FN3O3 and a molecular weight of 437.52 g/mol. Its IUPAC name is ethanimidoyl 4-[2-(1-cyclopropyl-2-hydroxy-2-methylpropyl)-3-oxo-1H-isoindol-4-yl]-3-fluoro-2-methylbenzenecarboximidate.
| Compound Name | ethanimidoyl 4-[2-(1-cyclopropyl-2-hydroxy-2-methylpropyl)-3-oxo-1H-isoindol-4-yl]-3-fluoro-2-methylbenzenecarboximidate |
|---|---|
| PubChem CID | 163382375 |
| Molecular Formula | C25H28FN3O3 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | ethanimidoyl 4-[2-(1-cyclopropyl-2-hydroxy-2-methylpropyl)-3-oxo-1H-isoindol-4-yl]-3-fluoro-2-methylbenzenecarboximidate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])c1ccc(-c2cccc3c2C(=O)N(C(C2CC2)C(C)(C)O)C3)c(F)c1C |
| InChI | InChI=1S/C25H28FN3O3/c1-13-17(23(28)32-14(2)27)10-11-19(21(13)26)18-7-5-6-16-12-29(24(30)20(16)18)22(15-8-9-15)25(3,4)31/h5-7,10-11,15,22,27-28,31H,8-9,12H2,1-4H3/b27-14+,28-23- |
| InChIKey | JLLDUZPXAUNBCM-FORJQHLJSA-N |
| XLogP | 4.65 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|