C25H29N3O2S — CID 167085650
ethanimidoyl 4-[2-[(1R)-1-cyclopropyl-2-hydroxy-2-methylpropyl]-3-oxo-1H-isoindol-4-yl]-2-methylbenzenecarboximidothioate (PubChem CID 167085650) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is ethanimidoyl 4-[2-[(1R)-1-cyclopropyl-2-hydroxy-2-methylpropyl]-3-oxo-1H-isoindol-4-yl]-2-methylbenzenecarboximidothioate.
| Compound Name | ethanimidoyl 4-[2-[(1R)-1-cyclopropyl-2-hydroxy-2-methylpropyl]-3-oxo-1H-isoindol-4-yl]-2-methylbenzenecarboximidothioate |
|---|---|
| PubChem CID | 167085650 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | ethanimidoyl 4-[2-[(1R)-1-cyclopropyl-2-hydroxy-2-methylpropyl]-3-oxo-1H-isoindol-4-yl]-2-methylbenzenecarboximidothioate |
| SMILES | [H]/N=C(\S/C(C)=N/[H])c1ccc(-c2cccc3c2C(=O)N([C@H](C2CC2)C(C)(C)O)C3)cc1C |
| InChI | InChI=1S/C25H29N3O2S/c1-14-12-17(10-11-19(14)23(27)31-15(2)26)20-7-5-6-18-13-28(24(29)21(18)20)22(16-8-9-16)25(3,4)30/h5-7,10-12,16,22,26-27,30H,8-9,13H2,1-4H3/b26-15+,27-23-/t22-/m1/s1 |
| InChIKey | WGNUPVZSUKJMMX-GQCBAKINSA-N |
| XLogP | 5.22 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|