C33H32BrF3N5O7P — CID 163384281
[[4-[12-[4-bromo-3-(trifluoromethyl)benzoyl]-5-(cyclopropylmethyl)-11-methylidene-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]benzoyl]-methylamino]methyl dimethyl phosphate (PubChem CID 163384281) has the molecular formula C33H32BrF3N5O7P and a molecular weight of 778.52 g/mol. Its IUPAC name is [[4-[12-[4-bromo-3-(trifluoromethyl)benzoyl]-5-(cyclopropylmethyl)-11-methylidene-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]benzoyl]-methylamino]methyl dimethyl phosphate.
| Compound Name | [[4-[12-[4-bromo-3-(trifluoromethyl)benzoyl]-5-(cyclopropylmethyl)-11-methylidene-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]benzoyl]-methylamino]methyl dimethyl phosphate |
|---|---|
| PubChem CID | 163384281 |
| Molecular Formula | C33H32BrF3N5O7P |
| Molecular Weight | 778.52 g/mol |
| Exact Mass | 777.12 |
| IUPAC Name | [[4-[12-[4-bromo-3-(trifluoromethyl)benzoyl]-5-(cyclopropylmethyl)-11-methylidene-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]benzoyl]-methylamino]methyl dimethyl phosphate |
| SMILES | C=C1Cc2c(n3ncc(CC4CC4)c3n(-c3ccc(C(=O)N(C)COP(=O)(OC)OC)cc3)c2=O)CN1C(=O)c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H32BrF3N5O7P/c1-19-13-25-28(17-40(19)31(44)22-9-12-27(34)26(15-22)33(35,36)37)42-29(23(16-38-42)14-20-5-6-20)41(32(25)45)24-10-7-21(8-11-24)30(43)39(2)18-49-50(46,47-3)48-4/h7-12,15-16,20H,1,5-6,13-14,17-18H2,2-4H3 |
| InChIKey | WWFGNERVPMTOLO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 124.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|