C25H30O4S2 — CID 163385075
5-[5-[2-(2-hydroxyethylsulfanyl)propan-2-ylsulfanyl]-2-oxopentyl]-3,4-dimethylxanthen-9-one (PubChem CID 163385075) has the molecular formula C25H30O4S2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 5-[5-[2-(2-hydroxyethylsulfanyl)propan-2-ylsulfanyl]-2-oxopentyl]-3,4-dimethylxanthen-9-one.
| Compound Name | 5-[5-[2-(2-hydroxyethylsulfanyl)propan-2-ylsulfanyl]-2-oxopentyl]-3,4-dimethylxanthen-9-one |
|---|---|
| PubChem CID | 163385075 |
| Molecular Formula | C25H30O4S2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 5-[5-[2-(2-hydroxyethylsulfanyl)propan-2-ylsulfanyl]-2-oxopentyl]-3,4-dimethylxanthen-9-one |
| SMILES | Cc1ccc2c(=O)c3cccc(CC(=O)CCCSC(C)(C)SCCO)c3oc2c1C |
| InChI | InChI=1S/C25H30O4S2/c1-16-10-11-21-22(28)20-9-5-7-18(24(20)29-23(21)17(16)2)15-19(27)8-6-13-30-25(3,4)31-14-12-26/h5,7,9-11,26H,6,8,12-15H2,1-4H3 |
| InChIKey | GAAIBDHUMWSBJB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|