C16H25FN2O4 — CID 163387871
tert-butyl N-[(2R)-1-[(5-amino-2-fluoro-4-methoxyphenyl)methoxy]propan-2-yl]carbamate (PubChem CID 163387871) has the molecular formula C16H25FN2O4 and a molecular weight of 328.38 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[(5-amino-2-fluoro-4-methoxyphenyl)methoxy]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[(5-amino-2-fluoro-4-methoxyphenyl)methoxy]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 163387871 |
| Molecular Formula | C16H25FN2O4 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | tert-butyl N-[(2R)-1-[(5-amino-2-fluoro-4-methoxyphenyl)methoxy]propan-2-yl]carbamate |
| SMILES | COc1cc(F)c(COC[C@@H](C)NC(=O)OC(C)(C)C)cc1N |
| InChI | InChI=1S/C16H25FN2O4/c1-10(19-15(20)23-16(2,3)4)8-22-9-11-6-13(18)14(21-5)7-12(11)17/h6-7,10H,8-9,18H2,1-5H3,(H,19,20)/t10-/m1/s1 |
| InChIKey | MYXPZTSWEROVFG-SNVBAGLBSA-N |
| XLogP | 2.85 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|