C21H15Cl2FN2O5 — CID 163388142
5-(4-chloro-2-fluorophenyl)-2-(4-chloro-3-nitrophenyl)-1-ethyl-6-methyl-4-oxopyridine-3-carboxylic acid (PubChem CID 163388142) has the molecular formula C21H15Cl2FN2O5 and a molecular weight of 465.26 g/mol. Its IUPAC name is 5-(4-chloro-2-fluorophenyl)-2-(4-chloro-3-nitrophenyl)-1-ethyl-6-methyl-4-oxopyridine-3-carboxylic acid.
| Compound Name | 5-(4-chloro-2-fluorophenyl)-2-(4-chloro-3-nitrophenyl)-1-ethyl-6-methyl-4-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 163388142 |
| Molecular Formula | C21H15Cl2FN2O5 |
| Molecular Weight | 465.26 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | 5-(4-chloro-2-fluorophenyl)-2-(4-chloro-3-nitrophenyl)-1-ethyl-6-methyl-4-oxopyridine-3-carboxylic acid |
| SMILES | CCn1c(C)c(-c2ccc(Cl)cc2F)c(=O)c(C(=O)O)c1-c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H15Cl2FN2O5/c1-3-25-10(2)17(13-6-5-12(22)9-15(13)24)20(27)18(21(28)29)19(25)11-4-7-14(23)16(8-11)26(30)31/h4-9H,3H2,1-2H3,(H,28,29) |
| InChIKey | DERMLIJLBPBQPZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.26 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|