C18H14Cl2F4N2 — CID 163389757
6-chloro-3-(4-chloro-3-fluorophenyl)-1-(2-methylpropyl)-2-(trifluoromethyl)pyrrolo[2,3-b]pyridine (PubChem CID 163389757) has the molecular formula C18H14Cl2F4N2 and a molecular weight of 405.22 g/mol. Its IUPAC name is 6-chloro-3-(4-chloro-3-fluorophenyl)-1-(2-methylpropyl)-2-(trifluoromethyl)pyrrolo[2,3-b]pyridine.
| Compound Name | 6-chloro-3-(4-chloro-3-fluorophenyl)-1-(2-methylpropyl)-2-(trifluoromethyl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 163389757 |
| Molecular Formula | C18H14Cl2F4N2 |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 6-chloro-3-(4-chloro-3-fluorophenyl)-1-(2-methylpropyl)-2-(trifluoromethyl)pyrrolo[2,3-b]pyridine |
| SMILES | CC(C)Cn1c(C(F)(F)F)c(-c2ccc(Cl)c(F)c2)c2ccc(Cl)nc21 |
| InChI | InChI=1S/C18H14Cl2F4N2/c1-9(2)8-26-16(18(22,23)24)15(10-3-5-12(19)13(21)7-10)11-4-6-14(20)25-17(11)26/h3-7,9H,8H2,1-2H3 |
| InChIKey | MGFWNQZHLQQVGE-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|