C21H16Cl2FN3 — CID 163389982
6-chloro-3-(4-chloro-3-fluorophenyl)-1-(2-pyridin-2-ylpropan-2-yl)pyrrolo[2,3-b]pyridine (PubChem CID 163389982) has the molecular formula C21H16Cl2FN3 and a molecular weight of 400.28 g/mol. Its IUPAC name is 6-chloro-3-(4-chloro-3-fluorophenyl)-1-(2-pyridin-2-ylpropan-2-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 6-chloro-3-(4-chloro-3-fluorophenyl)-1-(2-pyridin-2-ylpropan-2-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 163389982 |
| Molecular Formula | C21H16Cl2FN3 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 6-chloro-3-(4-chloro-3-fluorophenyl)-1-(2-pyridin-2-ylpropan-2-yl)pyrrolo[2,3-b]pyridine |
| SMILES | CC(C)(c1ccccn1)n1cc(-c2ccc(Cl)c(F)c2)c2ccc(Cl)nc21 |
| InChI | InChI=1S/C21H16Cl2FN3/c1-21(2,18-5-3-4-10-25-18)27-12-15(13-6-8-16(22)17(24)11-13)14-7-9-19(23)26-20(14)27/h3-12H,1-2H3 |
| InChIKey | ARSASWNFEXDJCV-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|