About methyl 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylate
methyl 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylate (PubChem CID 163390818) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is methyl 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylate |
| PubChem CID | 163390818 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | methyl 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(n1)CCOC2 |
| InChI | InChI=1S/C10H11NO3/c1-13-10(12)9-3-2-7-6-14-5-4-8(7)11-9/h2-3H,4-6H2,1H3 |
| InChIKey | FMIWIBHSMWBVMG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylate?
The IUPAC name of methyl 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylate (CID 163390818) is methyl 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylate.
What is the SMILES notation for methyl 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylate?
The canonical SMILES for methyl 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylate is COC(=O)c1ccc2c(n1)CCOC2.
What is the InChIKey of methyl 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylate?
The InChIKey is FMIWIBHSMWBVMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-13-10(12)9-3-2-7-6-14-5-4-8(7)11-9/h2-3H,4-6H2,1H3.
What are the key properties of methyl 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylate?
methyl 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylate has a molecular weight of 193.20 g/mol, XLogP of 0.94, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylate is sourced from PubChem (CID 163390818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).