C11H11NO3 — CID 135395002
methyl 6-oxo-7,8-dihydro-5H-quinoline-2-carboxylate (PubChem CID 135395002) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is methyl 6-oxo-7,8-dihydro-5H-quinoline-2-carboxylate.
| Compound Name | methyl 6-oxo-7,8-dihydro-5H-quinoline-2-carboxylate |
|---|---|
| PubChem CID | 135395002 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | methyl 6-oxo-7,8-dihydro-5H-quinoline-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(n1)CCC(=O)C2 |
| InChI | InChI=1S/C11H11NO3/c1-15-11(14)10-4-2-7-6-8(13)3-5-9(7)12-10/h2,4H,3,5-6H2,1H3 |
| InChIKey | DJICRTDFIQZSGG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |