About 1-[(5-amino-1,3,4-thiadiazol-2-yl)oxymethyl]cyclopropane-1-carbonitrile
1-[(5-amino-1,3,4-thiadiazol-2-yl)oxymethyl]cyclopropane-1-carbonitrile (PubChem CID 163391215) has the molecular formula C7H8N4OS
and a molecular weight of 196.23 g/mol. Its IUPAC name is 1-[(5-amino-1,3,4-thiadiazol-2-yl)oxymethyl]cyclopropane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-[(5-amino-1,3,4-thiadiazol-2-yl)oxymethyl]cyclopropane-1-carbonitrile |
| PubChem CID | 163391215 |
| Molecular Formula | C7H8N4OS |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 1-[(5-amino-1,3,4-thiadiazol-2-yl)oxymethyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(COc2nnc(N)s2)CC1 |
| InChI | InChI=1S/C7H8N4OS/c8-3-7(1-2-7)4-12-6-11-10-5(9)13-6/h1-2,4H2,(H2,9,10) |
| InChIKey | RRZUCNFTWNRGBL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(5-amino-1,3,4-thiadiazol-2-yl)oxymethyl]cyclopropane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-amino-1,3,4-thiadiazol-2-yl)oxymethyl]cyclopropane-1-carbonitrile?
The IUPAC name of 1-[(5-amino-1,3,4-thiadiazol-2-yl)oxymethyl]cyclopropane-1-carbonitrile (CID 163391215) is 1-[(5-amino-1,3,4-thiadiazol-2-yl)oxymethyl]cyclopropane-1-carbonitrile.
What is the SMILES notation for 1-[(5-amino-1,3,4-thiadiazol-2-yl)oxymethyl]cyclopropane-1-carbonitrile?
The canonical SMILES for 1-[(5-amino-1,3,4-thiadiazol-2-yl)oxymethyl]cyclopropane-1-carbonitrile is N#CC1(COc2nnc(N)s2)CC1.
What is the InChIKey of 1-[(5-amino-1,3,4-thiadiazol-2-yl)oxymethyl]cyclopropane-1-carbonitrile?
The InChIKey is RRZUCNFTWNRGBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4OS/c8-3-7(1-2-7)4-12-6-11-10-5(9)13-6/h1-2,4H2,(H2,9,10).
What are the key properties of 1-[(5-amino-1,3,4-thiadiazol-2-yl)oxymethyl]cyclopropane-1-carbonitrile?
1-[(5-amino-1,3,4-thiadiazol-2-yl)oxymethyl]cyclopropane-1-carbonitrile has a molecular weight of 196.23 g/mol, XLogP of 0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-amino-1,3,4-thiadiazol-2-yl)oxymethyl]cyclopropane-1-carbonitrile is sourced from PubChem (CID 163391215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).