C16H29N3O2SSi — CID 170550686
5-[[4-[tert-butyl(dimethyl)silyl]oxy-1-bicyclo[2.2.1]heptanyl]methoxy]-1,3,4-thiadiazol-2-amine (PubChem CID 170550686) has the molecular formula C16H29N3O2SSi and a molecular weight of 355.58 g/mol. Its IUPAC name is 5-[[4-[tert-butyl(dimethyl)silyl]oxy-1-bicyclo[2.2.1]heptanyl]methoxy]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[[4-[tert-butyl(dimethyl)silyl]oxy-1-bicyclo[2.2.1]heptanyl]methoxy]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 170550686 |
| Molecular Formula | C16H29N3O2SSi |
| Molecular Weight | 355.58 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 5-[[4-[tert-butyl(dimethyl)silyl]oxy-1-bicyclo[2.2.1]heptanyl]methoxy]-1,3,4-thiadiazol-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC12CCC(COc3nnc(N)s3)(CC1)C2 |
| InChI | InChI=1S/C16H29N3O2SSi/c1-14(2,3)23(4,5)21-16-8-6-15(10-16,7-9-16)11-20-13-19-18-12(17)22-13/h6-11H2,1-5H3,(H2,17,18) |
| InChIKey | AFVSVAJGKJMVSP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|