C14H27N3O2SSi — CID 171477556
5-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-1,3,4-thiadiazol-2-amine (PubChem CID 171477556) has the molecular formula C14H27N3O2SSi and a molecular weight of 329.54 g/mol. Its IUPAC name is 5-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 171477556 |
| Molecular Formula | C14H27N3O2SSi |
| Molecular Weight | 329.54 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 5-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-1,3,4-thiadiazol-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(Oc2nnc(N)s2)CC1 |
| InChI | InChI=1S/C14H27N3O2SSi/c1-14(2,3)21(4,5)19-11-8-6-10(7-9-11)18-13-17-16-12(15)20-13/h10-11H,6-9H2,1-5H3,(H2,15,16) |
| InChIKey | PSQHAUDDXZLTQA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|