C12H19N3O2S — CID 163390770
(Z,3E)-7-[(5-amino-1,3,4-thiadiazol-2-yl)oxy]-3-ethylidene-2-methylhept-4-en-2-ol (PubChem CID 163390770) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is (Z,3E)-7-[(5-amino-1,3,4-thiadiazol-2-yl)oxy]-3-ethylidene-2-methylhept-4-en-2-ol.
| Compound Name | (Z,3E)-7-[(5-amino-1,3,4-thiadiazol-2-yl)oxy]-3-ethylidene-2-methylhept-4-en-2-ol |
|---|---|
| PubChem CID | 163390770 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (Z,3E)-7-[(5-amino-1,3,4-thiadiazol-2-yl)oxy]-3-ethylidene-2-methylhept-4-en-2-ol |
| SMILES | C/C=C(\C=C/CCOc1nnc(N)s1)C(C)(C)O |
| InChI | InChI=1S/C12H19N3O2S/c1-4-9(12(2,3)16)7-5-6-8-17-11-15-14-10(13)18-11/h4-5,7,16H,6,8H2,1-3H3,(H2,13,14)/b7-5-,9-4+ |
| InChIKey | JZBLWDHICHXIDV-YQDRFQIPSA-N |
| XLogP | 2.16 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|