C16H32N2O2SSi — CID 170550808
O-[[4-[tert-butyl(dimethyl)silyl]oxy-1-bicyclo[2.2.2]octanyl]methyl] N-aminocarbamothioate (PubChem CID 170550808) has the molecular formula C16H32N2O2SSi and a molecular weight of 344.60 g/mol. Its IUPAC name is O-[[4-[tert-butyl(dimethyl)silyl]oxy-1-bicyclo[2.2.2]octanyl]methyl] N-aminocarbamothioate.
| Compound Name | O-[[4-[tert-butyl(dimethyl)silyl]oxy-1-bicyclo[2.2.2]octanyl]methyl] N-aminocarbamothioate |
|---|---|
| PubChem CID | 170550808 |
| Molecular Formula | C16H32N2O2SSi |
| Molecular Weight | 344.60 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | O-[[4-[tert-butyl(dimethyl)silyl]oxy-1-bicyclo[2.2.2]octanyl]methyl] N-aminocarbamothioate |
| SMILES | CC(C)(C)[Si](C)(C)OC12CCC(COC(=S)NN)(CC1)CC2 |
| InChI | InChI=1S/C16H32N2O2SSi/c1-14(2,3)22(4,5)20-16-9-6-15(7-10-16,8-11-16)12-19-13(21)18-17/h6-12,17H2,1-5H3,(H,18,21) |
| InChIKey | LSWAGRNMVHPHOO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|