C10H17FN2OS — CID 170550779
O-[(4-fluoro-1-bicyclo[2.2.2]octanyl)methyl] N-aminocarbamothioate (PubChem CID 170550779) has the molecular formula C10H17FN2OS and a molecular weight of 232.32 g/mol. Its IUPAC name is O-[(4-fluoro-1-bicyclo[2.2.2]octanyl)methyl] N-aminocarbamothioate.
| Compound Name | O-[(4-fluoro-1-bicyclo[2.2.2]octanyl)methyl] N-aminocarbamothioate |
|---|---|
| PubChem CID | 170550779 |
| Molecular Formula | C10H17FN2OS |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | O-[(4-fluoro-1-bicyclo[2.2.2]octanyl)methyl] N-aminocarbamothioate |
| SMILES | NNC(=S)OCC12CCC(F)(CC1)CC2 |
| InChI | InChI=1S/C10H17FN2OS/c11-10-4-1-9(2-5-10,3-6-10)7-14-8(15)13-12/h1-7,12H2,(H,13,15) |
| InChIKey | QSHQSFVLGVQOTJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|