C16H11F9O7S — CID 163392765
ethyl (2S)-7-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)-4-oxo-2,3-dihydrochromene-2-carboxylate (PubChem CID 163392765) has the molecular formula C16H11F9O7S and a molecular weight of 518.31 g/mol. Its IUPAC name is ethyl (2S)-7-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)-4-oxo-2,3-dihydrochromene-2-carboxylate.
| Compound Name | ethyl (2S)-7-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)-4-oxo-2,3-dihydrochromene-2-carboxylate |
|---|---|
| PubChem CID | 163392765 |
| Molecular Formula | C16H11F9O7S |
| Molecular Weight | 518.31 g/mol |
| Exact Mass | 518.01 |
| IUPAC Name | ethyl (2S)-7-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)-4-oxo-2,3-dihydrochromene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC(=O)c2ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2O1 |
| InChI | InChI=1S/C16H11F9O7S/c1-2-30-12(27)11-6-9(26)8-4-3-7(5-10(8)31-11)32-33(28,29)16(24,25)14(19,20)13(17,18)15(21,22)23/h3-5,11H,2,6H2,1H3/t11-/m0/s1 |
| InChIKey | JINOTKULHMBXKJ-NSHDSACASA-N |
| XLogP | 3.72 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|