C9H10NO2Y- — CID 163392787
[(4-methoxyphenyl)methylamino]methanone;yttrium (PubChem CID 163392787) has the molecular formula C9H10NO2Y- and a molecular weight of 253.09 g/mol. Its IUPAC name is [(4-methoxyphenyl)methylamino]methanone;yttrium.
| Compound Name | [(4-methoxyphenyl)methylamino]methanone;yttrium |
|---|---|
| PubChem CID | 163392787 |
| Molecular Formula | C9H10NO2Y- |
| Molecular Weight | 253.09 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | [(4-methoxyphenyl)methylamino]methanone;yttrium |
| SMILES | COc1ccc(CN[C-]=O)cc1.[Y] |
| InChI | InChI=1S/C9H10NO2.Y/c1-12-9-4-2-8(3-5-9)6-10-7-11;/h2-5H,6H2,1H3,(H,10,11);/q-1; |
| InChIKey | BIOGCABUFAFDPH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.09 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|