C11H17NS — CID 163393108
(3Z)-N,4-dimethyl-3-prop-2-enylidenethiophen-2-imine;ethane (PubChem CID 163393108) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is (3Z)-N,4-dimethyl-3-prop-2-enylidenethiophen-2-imine;ethane.
| Compound Name | (3Z)-N,4-dimethyl-3-prop-2-enylidenethiophen-2-imine;ethane |
|---|---|
| PubChem CID | 163393108 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | (3Z)-N,4-dimethyl-3-prop-2-enylidenethiophen-2-imine;ethane |
| SMILES | C=C/C=C1/C(C)=CS/C1=N\C.CC |
| InChI | InChI=1S/C9H11NS.C2H6/c1-4-5-8-7(2)6-11-9(8)10-3;1-2/h4-6H,1H2,2-3H3;1-2H3/b8-5-,10-9-; |
| InChIKey | MNGUVFBJZBAREH-KSRZDLMISA-N |
| XLogP | 3.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|