C14H27NS — CID 143483188
ethane;ethene;[(3Z)-6-methylhepta-3,5-dienyl] N-methylmethanimidothioate (PubChem CID 143483188) has the molecular formula C14H27NS and a molecular weight of 241.44 g/mol. Its IUPAC name is ethane;ethene;[(3Z)-6-methylhepta-3,5-dienyl] N-methylmethanimidothioate.
| Compound Name | ethane;ethene;[(3Z)-6-methylhepta-3,5-dienyl] N-methylmethanimidothioate |
|---|---|
| PubChem CID | 143483188 |
| Molecular Formula | C14H27NS |
| Molecular Weight | 241.44 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | ethane;ethene;[(3Z)-6-methylhepta-3,5-dienyl] N-methylmethanimidothioate |
| SMILES | C/N=C/SCC/C=C\C=C(C)C.C=C.CC |
| InChI | InChI=1S/C10H17NS.C2H6.C2H4/c1-10(2)7-5-4-6-8-12-9-11-3;2*1-2/h4-5,7,9H,6,8H2,1-3H3;1-2H3;1-2H2/b5-4-,11-9+;; |
| InChIKey | TWRQBODHGQGDSO-QBADXZKUSA-N |
| XLogP | 5.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|