C12H17NS — CID 166459031
1-(4-ethylcyclohexa-1,3-dien-1-yl)ethenyl N-methylmethanimidothioate (PubChem CID 166459031) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethenyl N-methylmethanimidothioate.
| Compound Name | 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethenyl N-methylmethanimidothioate |
|---|---|
| PubChem CID | 166459031 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethenyl N-methylmethanimidothioate |
| SMILES | C=C(S/C=N/C)C1=CC=C(CC)CC1 |
| InChI | InChI=1S/C12H17NS/c1-4-11-5-7-12(8-6-11)10(2)14-9-13-3/h5,7,9H,2,4,6,8H2,1,3H3/b13-9+ |
| InChIKey | QTDFHBJGGMGOMG-UKTHLTGXSA-N |
| XLogP | 3.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|