C13H19NS — CID 171105189
[(4Z)-7-methyl-3,6-dimethylideneocta-1,4-dien-2-yl] N-methylmethanimidothioate (PubChem CID 171105189) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is [(4Z)-7-methyl-3,6-dimethylideneocta-1,4-dien-2-yl] N-methylmethanimidothioate.
| Compound Name | [(4Z)-7-methyl-3,6-dimethylideneocta-1,4-dien-2-yl] N-methylmethanimidothioate |
|---|---|
| PubChem CID | 171105189 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | [(4Z)-7-methyl-3,6-dimethylideneocta-1,4-dien-2-yl] N-methylmethanimidothioate |
| SMILES | C=C(/C=C\C(=C)C(C)C)C(=C)S/C=N/C |
| InChI | InChI=1S/C13H19NS/c1-10(2)11(3)7-8-12(4)13(5)15-9-14-6/h7-10H,3-5H2,1-2,6H3/b8-7-,14-9+ |
| InChIKey | INNFDTXNKIPHEU-JEHBAHQJSA-N |
| XLogP | 4.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|