C11H15NS — CID 155707553
[(4Z)-6-methyl-3-methylidenehepta-1,4,6-trien-2-yl] N-methylmethanimidothioate (PubChem CID 155707553) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is [(4Z)-6-methyl-3-methylidenehepta-1,4,6-trien-2-yl] N-methylmethanimidothioate.
| Compound Name | [(4Z)-6-methyl-3-methylidenehepta-1,4,6-trien-2-yl] N-methylmethanimidothioate |
|---|---|
| PubChem CID | 155707553 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | [(4Z)-6-methyl-3-methylidenehepta-1,4,6-trien-2-yl] N-methylmethanimidothioate |
| SMILES | C=C(C)/C=C\C(=C)C(=C)S/C=N/C |
| InChI | InChI=1S/C11H15NS/c1-9(2)6-7-10(3)11(4)13-8-12-5/h6-8H,1,3-4H2,2,5H3/b7-6-,12-8+ |
| InChIKey | RUUULVOGRDQMAA-UGLNBITBSA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|