C10H17NS — CID 143483189
[(3Z)-6-methylhepta-3,5-dienyl] N-methylmethanimidothioate (PubChem CID 143483189) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is [(3Z)-6-methylhepta-3,5-dienyl] N-methylmethanimidothioate.
| Compound Name | [(3Z)-6-methylhepta-3,5-dienyl] N-methylmethanimidothioate |
|---|---|
| PubChem CID | 143483189 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | [(3Z)-6-methylhepta-3,5-dienyl] N-methylmethanimidothioate |
| SMILES | C/N=C/SCC/C=C\C=C(C)C |
| InChI | InChI=1S/C10H17NS/c1-10(2)7-5-4-6-8-12-9-11-3/h4-5,7,9H,6,8H2,1-3H3/b5-4-,11-9+ |
| InChIKey | DGCAEJCCMYPYHO-JHGYFVHDSA-N |
| XLogP | 3.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|