C14H23NS — CID 123514781
2-ethylpent-3-enyl N-(2-ethenylbut-2-enyl)methanimidothioate (PubChem CID 123514781) has the molecular formula C14H23NS and a molecular weight of 237.41 g/mol. Its IUPAC name is 2-ethylpent-3-enyl N-(2-ethenylbut-2-enyl)methanimidothioate.
| Compound Name | 2-ethylpent-3-enyl N-(2-ethenylbut-2-enyl)methanimidothioate |
|---|---|
| PubChem CID | 123514781 |
| Molecular Formula | C14H23NS |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 2-ethylpent-3-enyl N-(2-ethenylbut-2-enyl)methanimidothioate |
| SMILES | C=CC(=CC)C/N=C/SCC(C=CC)CC |
| InChI | InChI=1S/C14H23NS/c1-5-9-14(8-4)11-16-12-15-10-13(6-2)7-3/h5-7,9,12,14H,2,8,10-11H2,1,3-4H3/b9-5?,13-7?,15-12+ |
| InChIKey | DKZIHRJVWCNEOU-GTFUWAHWSA-N |
| XLogP | 4.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|