C11H17NS — CID 157202860
3a,7a-dihydro-1,3-benzothiazole;2-methylpropane (PubChem CID 157202860) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is 3a,7a-dihydro-1,3-benzothiazole;2-methylpropane.
| Compound Name | 3a,7a-dihydro-1,3-benzothiazole;2-methylpropane |
|---|---|
| PubChem CID | 157202860 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 3a,7a-dihydro-1,3-benzothiazole;2-methylpropane |
| SMILES | C1=CC2N=CSC2C=C1.CC(C)C |
| InChI | InChI=1S/C7H7NS.C4H10/c1-2-4-7-6(3-1)8-5-9-7;1-4(2)3/h1-7H;4H,1-3H3 |
| InChIKey | AQZSKATVPNKQIR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |