C9H11NS — CID 163393001
(3Z)-N,4-dimethyl-3-prop-2-enylidenethiophen-2-imine (PubChem CID 163393001) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is (3Z)-N,4-dimethyl-3-prop-2-enylidenethiophen-2-imine.
| Compound Name | (3Z)-N,4-dimethyl-3-prop-2-enylidenethiophen-2-imine |
|---|---|
| PubChem CID | 163393001 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (3Z)-N,4-dimethyl-3-prop-2-enylidenethiophen-2-imine |
| SMILES | C=C/C=C1/C(C)=CS/C1=N\C |
| InChI | InChI=1S/C9H11NS/c1-4-5-8-7(2)6-11-9(8)10-3/h4-6H,1H2,2-3H3/b8-5-,10-9- |
| InChIKey | TZVBWPVESHRVAT-IVXNCWGASA-N |
| XLogP | 2.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|