C24H37NS — CID 143712501
ethenyl (3Z,4E)-4-butylidene-N-methyl-3-pentylidenecyclohexa-1,5-diene-1-carboximidothioate;2-methylbut-1-ene (PubChem CID 143712501) has the molecular formula C24H37NS and a molecular weight of 371.63 g/mol. Its IUPAC name is ethenyl (3Z,4E)-4-butylidene-N-methyl-3-pentylidenecyclohexa-1,5-diene-1-carboximidothioate;2-methylbut-1-ene.
| Compound Name | ethenyl (3Z,4E)-4-butylidene-N-methyl-3-pentylidenecyclohexa-1,5-diene-1-carboximidothioate;2-methylbut-1-ene |
|---|---|
| PubChem CID | 143712501 |
| Molecular Formula | C24H37NS |
| Molecular Weight | 371.63 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | ethenyl (3Z,4E)-4-butylidene-N-methyl-3-pentylidenecyclohexa-1,5-diene-1-carboximidothioate;2-methylbut-1-ene |
| SMILES | C=C(C)CC.C=CS/C(=N\C)c1ccc(=C\CCC)/c(=C\CCCC)c1 |
| InChI | InChI=1S/C19H27NS.C5H10/c1-5-8-10-12-17-15-18(19(20-4)21-7-3)14-13-16(17)11-9-6-2;1-4-5(2)3/h7,11-15H,3,5-6,8-10H2,1-2,4H3;2,4H2,1,3H3/b16-11+,17-12-,20-19-; |
| InChIKey | ZBFPPRMVMMQJCQ-MTJYITEUSA-N |
| XLogP | 6.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.63 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|