C18H27F — CID 91344627
6-butylidene-5-(5,5-dimethylhexylidene)-2-fluorocyclohexa-1,3-diene (PubChem CID 91344627) has the molecular formula C18H27F and a molecular weight of 262.41 g/mol. Its IUPAC name is 6-butylidene-5-(5,5-dimethylhexylidene)-2-fluorocyclohexa-1,3-diene.
| Compound Name | 6-butylidene-5-(5,5-dimethylhexylidene)-2-fluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 91344627 |
| Molecular Formula | C18H27F |
| Molecular Weight | 262.41 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 6-butylidene-5-(5,5-dimethylhexylidene)-2-fluorocyclohexa-1,3-diene |
| SMILES | CCCC=c1cc(F)ccc1=CCCCC(C)(C)C |
| InChI | InChI=1S/C18H27F/c1-5-6-9-16-14-17(19)12-11-15(16)10-7-8-13-18(2,3)4/h9-12,14H,5-8,13H2,1-4H3 |
| InChIKey | WKPHVEMJKBMFQN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|