C23H32N2O2S2 — CID 144501961
ethane;ethenyl 4-[4-[3-amino-4-hydroxy-3-(hydroxymethyl)butyl]phenyl]sulfanyl-N-methylbenzenecarboximidothioate (PubChem CID 144501961) has the molecular formula C23H32N2O2S2 and a molecular weight of 432.66 g/mol. Its IUPAC name is ethane;ethenyl 4-[4-[3-amino-4-hydroxy-3-(hydroxymethyl)butyl]phenyl]sulfanyl-N-methylbenzenecarboximidothioate.
| Compound Name | ethane;ethenyl 4-[4-[3-amino-4-hydroxy-3-(hydroxymethyl)butyl]phenyl]sulfanyl-N-methylbenzenecarboximidothioate |
|---|---|
| PubChem CID | 144501961 |
| Molecular Formula | C23H32N2O2S2 |
| Molecular Weight | 432.66 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | ethane;ethenyl 4-[4-[3-amino-4-hydroxy-3-(hydroxymethyl)butyl]phenyl]sulfanyl-N-methylbenzenecarboximidothioate |
| SMILES | C=CS/C(=N\C)c1ccc(Sc2ccc(CCC(N)(CO)CO)cc2)cc1.CC |
| InChI | InChI=1S/C21H26N2O2S2.C2H6/c1-3-26-20(23-2)17-6-10-19(11-7-17)27-18-8-4-16(5-9-18)12-13-21(22,14-24)15-25;1-2/h3-11,24-25H,1,12-15,22H2,2H3;1-2H3/b23-20-; |
| InChIKey | OADQRIOPDCXMNT-QTXBERLJSA-N |
| XLogP | 4.73 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.66 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|