C16H30N2O2 — CID 144696091
2-amino-2-[2-[4-(methyliminomethyl)phenyl]ethyl]propane-1,3-diol;ethane;methane (PubChem CID 144696091) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-amino-2-[2-[4-(methyliminomethyl)phenyl]ethyl]propane-1,3-diol;ethane;methane.
| Compound Name | 2-amino-2-[2-[4-(methyliminomethyl)phenyl]ethyl]propane-1,3-diol;ethane;methane |
|---|---|
| PubChem CID | 144696091 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 2-amino-2-[2-[4-(methyliminomethyl)phenyl]ethyl]propane-1,3-diol;ethane;methane |
| SMILES | C.C/N=C/c1ccc(CCC(N)(CO)CO)cc1.CC |
| InChI | InChI=1S/C13H20N2O2.C2H6.CH4/c1-15-8-12-4-2-11(3-5-12)6-7-13(14,9-16)10-17;1-2;/h2-5,8,16-17H,6-7,9-10,14H2,1H3;1-2H3;1H4/b15-8+;; |
| InChIKey | ADJVFLHTRBKNJG-OLIKVXRNSA-N |
| XLogP | 2.01 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|