About 1-(4-butoxyphenyl)prop-1-en-1-ol;ethane;2-methylbut-1-ene
1-(4-butoxyphenyl)prop-1-en-1-ol;ethane;2-methylbut-1-ene (PubChem CID 143299970) has the molecular formula C20H34O2
and a molecular weight of 306.49 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)prop-1-en-1-ol;ethane;2-methylbut-1-ene.
Molecular Properties
| Compound Name | 1-(4-butoxyphenyl)prop-1-en-1-ol;ethane;2-methylbut-1-ene |
| PubChem CID | 143299970 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 1-(4-butoxyphenyl)prop-1-en-1-ol;ethane;2-methylbut-1-ene |
| SMILES | C=C(C)CC.CC.CC=C(O)c1ccc(OCCCC)cc1 |
| InChI | InChI=1S/C13H18O2.C5H10.C2H6/c1-3-5-10-15-12-8-6-11(7-9-12)13(14)4-2;1-4-5(2)3;1-2/h4,6-9,14H,3,5,10H2,1-2H3;2,4H2,1,3H3;1-2H3 |
| InChIKey | GIGNICHVAOSQOS-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-butoxyphenyl)prop-1-en-1-ol;ethane;2-methylbut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-butoxyphenyl)prop-1-en-1-ol;ethane;2-methylbut-1-ene?
The IUPAC name of 1-(4-butoxyphenyl)prop-1-en-1-ol;ethane;2-methylbut-1-ene (CID 143299970) is 1-(4-butoxyphenyl)prop-1-en-1-ol;ethane;2-methylbut-1-ene.
What is the SMILES notation for 1-(4-butoxyphenyl)prop-1-en-1-ol;ethane;2-methylbut-1-ene?
The canonical SMILES for 1-(4-butoxyphenyl)prop-1-en-1-ol;ethane;2-methylbut-1-ene is C=C(C)CC.CC.CC=C(O)c1ccc(OCCCC)cc1.
What is the InChIKey of 1-(4-butoxyphenyl)prop-1-en-1-ol;ethane;2-methylbut-1-ene?
The InChIKey is GIGNICHVAOSQOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2.C5H10.C2H6/c1-3-5-10-15-12-8-6-11(7-9-12)13(14)4-2;1-4-5(2)3;1-2/h4,6-9,14H,3,5,10H2,1-2H3;2,4H2,1,3H3;1-2H3.
What are the key properties of 1-(4-butoxyphenyl)prop-1-en-1-ol;ethane;2-methylbut-1-ene?
1-(4-butoxyphenyl)prop-1-en-1-ol;ethane;2-methylbut-1-ene has a molecular weight of 306.49 g/mol, XLogP of 6.78, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-butoxyphenyl)prop-1-en-1-ol;ethane;2-methylbut-1-ene is sourced from PubChem (CID 143299970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).