C16H27NS — CID 171105448
ethane;[(3E,5Z,7Z)-6-propan-2-ylnona-1,3,5,7-tetraen-2-yl] N-methylmethanimidothioate (PubChem CID 171105448) has the molecular formula C16H27NS and a molecular weight of 265.47 g/mol. Its IUPAC name is ethane;[(3E,5Z,7Z)-6-propan-2-ylnona-1,3,5,7-tetraen-2-yl] N-methylmethanimidothioate.
| Compound Name | ethane;[(3E,5Z,7Z)-6-propan-2-ylnona-1,3,5,7-tetraen-2-yl] N-methylmethanimidothioate |
|---|---|
| PubChem CID | 171105448 |
| Molecular Formula | C16H27NS |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | ethane;[(3E,5Z,7Z)-6-propan-2-ylnona-1,3,5,7-tetraen-2-yl] N-methylmethanimidothioate |
| SMILES | C=C(/C=C/C=C(\C=C/C)C(C)C)S/C=N/C.CC |
| InChI | InChI=1S/C14H21NS.C2H6/c1-6-8-14(12(2)3)10-7-9-13(4)16-11-15-5;1-2/h6-12H,4H2,1-3,5H3;1-2H3/b8-6-,9-7+,14-10+,15-11+; |
| InChIKey | DYKLACWLFQUIGE-JGCOCLQKSA-N |
| XLogP | 5.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|