C14H21NS — CID 171105449
[(3E,5Z,7Z)-6-propan-2-ylnona-1,3,5,7-tetraen-2-yl] N-methylmethanimidothioate (PubChem CID 171105449) has the molecular formula C14H21NS and a molecular weight of 235.40 g/mol. Its IUPAC name is [(3E,5Z,7Z)-6-propan-2-ylnona-1,3,5,7-tetraen-2-yl] N-methylmethanimidothioate.
| Compound Name | [(3E,5Z,7Z)-6-propan-2-ylnona-1,3,5,7-tetraen-2-yl] N-methylmethanimidothioate |
|---|---|
| PubChem CID | 171105449 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | [(3E,5Z,7Z)-6-propan-2-ylnona-1,3,5,7-tetraen-2-yl] N-methylmethanimidothioate |
| SMILES | C=C(/C=C/C=C(\C=C/C)C(C)C)S/C=N/C |
| InChI | InChI=1S/C14H21NS/c1-6-8-14(12(2)3)10-7-9-13(4)16-11-15-5/h6-12H,4H2,1-3,5H3/b8-6-,9-7+,14-10+,15-11+ |
| InChIKey | KFCYYKICXYONOA-UIFXSMCVSA-N |
| XLogP | 4.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|