C21H23F3N6O2S — CID 163393427
3-[(Z)-1-amino-2-[amino-(1-cyanocyclopropyl)amino]ethenyl]-N-methyl-4-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide (PubChem CID 163393427) has the molecular formula C21H23F3N6O2S and a molecular weight of 480.52 g/mol. Its IUPAC name is 3-[(Z)-1-amino-2-[amino-(1-cyanocyclopropyl)amino]ethenyl]-N-methyl-4-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide.
| Compound Name | 3-[(Z)-1-amino-2-[amino-(1-cyanocyclopropyl)amino]ethenyl]-N-methyl-4-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 163393427 |
| Molecular Formula | C21H23F3N6O2S |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 3-[(Z)-1-amino-2-[amino-(1-cyanocyclopropyl)amino]ethenyl]-N-methyl-4-[[4-(trifluoromethyl)phenyl]methylamino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCc2ccc(C(F)(F)F)cc2)c(/C(N)=C/N(N)C2(C#N)CC2)c1 |
| InChI | InChI=1S/C21H23F3N6O2S/c1-28-33(31,32)16-6-7-19(29-11-14-2-4-15(5-3-14)21(22,23)24)17(10-16)18(26)12-30(27)20(13-25)8-9-20/h2-7,10,12,28-29H,8-9,11,26-27H2,1H3/b18-12- |
| InChIKey | KBLJRWFXFHMYGI-PDGQHHTCSA-N |
| XLogP | 2.71 |
| TPSA | 137.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|