C18H16F3N3 — CID 163393543
2-(1-methylimidazol-4-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]aniline (PubChem CID 163393543) has the molecular formula C18H16F3N3 and a molecular weight of 331.34 g/mol. Its IUPAC name is 2-(1-methylimidazol-4-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]aniline.
| Compound Name | 2-(1-methylimidazol-4-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 163393543 |
| Molecular Formula | C18H16F3N3 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-(1-methylimidazol-4-yl)-N-[[4-(trifluoromethyl)phenyl]methyl]aniline |
| SMILES | Cn1cnc(-c2ccccc2NCc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C18H16F3N3/c1-24-11-17(23-12-24)15-4-2-3-5-16(15)22-10-13-6-8-14(9-7-13)18(19,20)21/h2-9,11-12,22H,10H2,1H3 |
| InChIKey | YPVJRUCTUWVBMD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |