C26H34F3N5O3 — CID 163393345
2-[2-[2-(methylamino)ethoxy]ethoxy]ethanamine;3-(1-methylimidazol-4-yl)-4-[[4-(trifluoromethyl)phenyl]methylamino]benzaldehyde (PubChem CID 163393345) has the molecular formula C26H34F3N5O3 and a molecular weight of 521.58 g/mol. Its IUPAC name is 2-[2-[2-(methylamino)ethoxy]ethoxy]ethanamine;3-(1-methylimidazol-4-yl)-4-[[4-(trifluoromethyl)phenyl]methylamino]benzaldehyde.
| Compound Name | 2-[2-[2-(methylamino)ethoxy]ethoxy]ethanamine;3-(1-methylimidazol-4-yl)-4-[[4-(trifluoromethyl)phenyl]methylamino]benzaldehyde |
|---|---|
| PubChem CID | 163393345 |
| Molecular Formula | C26H34F3N5O3 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | 2-[2-[2-(methylamino)ethoxy]ethoxy]ethanamine;3-(1-methylimidazol-4-yl)-4-[[4-(trifluoromethyl)phenyl]methylamino]benzaldehyde |
| SMILES | CNCCOCCOCCN.Cn1cnc(-c2cc(C=O)ccc2NCc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H16F3N3O.C7H18N2O2/c1-25-10-18(24-12-25)16-8-14(11-26)4-7-17(16)23-9-13-2-5-15(6-3-13)19(20,21)22;1-9-3-5-11-7-6-10-4-2-8/h2-8,10-12,23H,9H2,1H3;9H,2-8H2,1H3 |
| InChIKey | QCVPEEJEPCNNQD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|