C23H23ClF3N3O2 — CID 176890472
tert-butyl N-[4-(chloromethyl)-2-(1-methylimidazol-4-yl)phenyl]-N-[4-(trifluoromethyl)phenyl]carbamate (PubChem CID 176890472) has the molecular formula C23H23ClF3N3O2 and a molecular weight of 465.90 g/mol. Its IUPAC name is tert-butyl N-[4-(chloromethyl)-2-(1-methylimidazol-4-yl)phenyl]-N-[4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(chloromethyl)-2-(1-methylimidazol-4-yl)phenyl]-N-[4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 176890472 |
| Molecular Formula | C23H23ClF3N3O2 |
| Molecular Weight | 465.90 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | tert-butyl N-[4-(chloromethyl)-2-(1-methylimidazol-4-yl)phenyl]-N-[4-(trifluoromethyl)phenyl]carbamate |
| SMILES | Cn1cnc(-c2cc(CCl)ccc2N(C(=O)OC(C)(C)C)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C23H23ClF3N3O2/c1-22(2,3)32-21(31)30(17-8-6-16(7-9-17)23(25,26)27)20-10-5-15(12-24)11-18(20)19-13-29(4)14-28-19/h5-11,13-14H,12H2,1-4H3 |
| InChIKey | UTFNJJJQTQTFBJ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.90 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|