C22H20F3N3O — CID 167565620
2-cyclopropyl-1-[3-(1-methylimidazol-4-yl)-4-[4-(trifluoromethyl)anilino]phenyl]ethanone (PubChem CID 167565620) has the molecular formula C22H20F3N3O and a molecular weight of 399.42 g/mol. Its IUPAC name is 2-cyclopropyl-1-[3-(1-methylimidazol-4-yl)-4-[4-(trifluoromethyl)anilino]phenyl]ethanone.
| Compound Name | 2-cyclopropyl-1-[3-(1-methylimidazol-4-yl)-4-[4-(trifluoromethyl)anilino]phenyl]ethanone |
|---|---|
| PubChem CID | 167565620 |
| Molecular Formula | C22H20F3N3O |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-cyclopropyl-1-[3-(1-methylimidazol-4-yl)-4-[4-(trifluoromethyl)anilino]phenyl]ethanone |
| SMILES | Cn1cnc(-c2cc(C(=O)CC3CC3)ccc2Nc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C22H20F3N3O/c1-28-12-20(26-13-28)18-11-15(21(29)10-14-2-3-14)4-9-19(18)27-17-7-5-16(6-8-17)22(23,24)25/h4-9,11-14,27H,2-3,10H2,1H3 |
| InChIKey | JADXTOHGYYNLRV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |