C22H19F3N4O2 — CID 174174053
3-methyl-3-[3-(1-methylimidazol-4-yl)-4-[4-(trifluoromethyl)anilino]phenyl]pyrrolidine-2,4-dione (PubChem CID 174174053) has the molecular formula C22H19F3N4O2 and a molecular weight of 428.41 g/mol. Its IUPAC name is 3-methyl-3-[3-(1-methylimidazol-4-yl)-4-[4-(trifluoromethyl)anilino]phenyl]pyrrolidine-2,4-dione.
| Compound Name | 3-methyl-3-[3-(1-methylimidazol-4-yl)-4-[4-(trifluoromethyl)anilino]phenyl]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 174174053 |
| Molecular Formula | C22H19F3N4O2 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 3-methyl-3-[3-(1-methylimidazol-4-yl)-4-[4-(trifluoromethyl)anilino]phenyl]pyrrolidine-2,4-dione |
| SMILES | Cn1cnc(-c2cc(C3(C)C(=O)CNC3=O)ccc2Nc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C22H19F3N4O2/c1-21(19(30)10-26-20(21)31)14-5-8-17(16(9-14)18-11-29(2)12-27-18)28-15-6-3-13(4-7-15)22(23,24)25/h3-9,11-12,28H,10H2,1-2H3,(H,26,31) |
| InChIKey | QMVSFGCPFFJUPF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|