C18H12F3N3O2 — CID 138681877
3-pyrimidin-2-yl-4-[4-(trifluoromethyl)anilino]benzoic acid (PubChem CID 138681877) has the molecular formula C18H12F3N3O2 and a molecular weight of 359.31 g/mol. Its IUPAC name is 3-pyrimidin-2-yl-4-[4-(trifluoromethyl)anilino]benzoic acid.
| Compound Name | 3-pyrimidin-2-yl-4-[4-(trifluoromethyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 138681877 |
| Molecular Formula | C18H12F3N3O2 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 3-pyrimidin-2-yl-4-[4-(trifluoromethyl)anilino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2ccc(C(F)(F)F)cc2)c(-c2ncccn2)c1 |
| InChI | InChI=1S/C18H12F3N3O2/c19-18(20,21)12-3-5-13(6-4-12)24-15-7-2-11(17(25)26)10-14(15)16-22-8-1-9-23-16/h1-10,24H,(H,25,26) |
| InChIKey | UYUZTMAOXLBUEB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |