C16H12F3N5O2 — CID 138682279
3-(2-methyltetrazol-5-yl)-4-[4-(trifluoromethyl)anilino]benzoic acid (PubChem CID 138682279) has the molecular formula C16H12F3N5O2 and a molecular weight of 363.30 g/mol. Its IUPAC name is 3-(2-methyltetrazol-5-yl)-4-[4-(trifluoromethyl)anilino]benzoic acid.
| Compound Name | 3-(2-methyltetrazol-5-yl)-4-[4-(trifluoromethyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 138682279 |
| Molecular Formula | C16H12F3N5O2 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 3-(2-methyltetrazol-5-yl)-4-[4-(trifluoromethyl)anilino]benzoic acid |
| SMILES | Cn1nnc(-c2cc(C(=O)O)ccc2Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C16H12F3N5O2/c1-24-22-14(21-23-24)12-8-9(15(25)26)2-7-13(12)20-11-5-3-10(4-6-11)16(17,18)19/h2-8,20H,1H3,(H,25,26) |
| InChIKey | CBSRAXYSLAZGIG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |