C16H21F3N2O — CID 163393832
(3R)-1-(1-methoxyprop-2-enyl)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine (PubChem CID 163393832) has the molecular formula C16H21F3N2O and a molecular weight of 314.35 g/mol. Its IUPAC name is (3R)-1-(1-methoxyprop-2-enyl)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine.
| Compound Name | (3R)-1-(1-methoxyprop-2-enyl)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 163393832 |
| Molecular Formula | C16H21F3N2O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (3R)-1-(1-methoxyprop-2-enyl)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine |
| SMILES | C=CC(OC)N1CC[C@@H](NCc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H21F3N2O/c1-3-15(22-2)21-8-7-14(11-21)20-10-12-5-4-6-13(9-12)16(17,18)19/h3-6,9,14-15,20H,1,7-8,10-11H2,2H3/t14-,15?/m1/s1 |
| InChIKey | JFZAGCOOEQALSL-GICMACPYSA-N |
| XLogP | 3.03 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|