C20H24ClFN2O5 — CID 163394166
tert-butyl (3aR,7aR)-2-(3-chloro-4-methoxycarbonylphenyl)-7a-fluoro-1-oxo-3a,4,6,7-tetrahydro-3H-pyrrolo[3,4-c]pyridine-5-carboxylate (PubChem CID 163394166) has the molecular formula C20H24ClFN2O5 and a molecular weight of 426.87 g/mol. Its IUPAC name is tert-butyl (3aR,7aR)-2-(3-chloro-4-methoxycarbonylphenyl)-7a-fluoro-1-oxo-3a,4,6,7-tetrahydro-3H-pyrrolo[3,4-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl (3aR,7aR)-2-(3-chloro-4-methoxycarbonylphenyl)-7a-fluoro-1-oxo-3a,4,6,7-tetrahydro-3H-pyrrolo[3,4-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 163394166 |
| Molecular Formula | C20H24ClFN2O5 |
| Molecular Weight | 426.87 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | tert-butyl (3aR,7aR)-2-(3-chloro-4-methoxycarbonylphenyl)-7a-fluoro-1-oxo-3a,4,6,7-tetrahydro-3H-pyrrolo[3,4-c]pyridine-5-carboxylate |
| SMILES | COC(=O)c1ccc(N2C[C@@H]3CN(C(=O)OC(C)(C)C)CC[C@]3(F)C2=O)cc1Cl |
| InChI | InChI=1S/C20H24ClFN2O5/c1-19(2,3)29-18(27)23-8-7-20(22)12(10-23)11-24(17(20)26)13-5-6-14(15(21)9-13)16(25)28-4/h5-6,9,12H,7-8,10-11H2,1-4H3/t12-,20+/m0/s1 |
| InChIKey | IANFZIYNWNLEOL-FKIZINRSSA-N |
| XLogP | 3.44 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.87 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |