C19H31FN2O5 — CID 167108356
tert-butyl (3aR,7aR)-2-(3-ethoxy-2,2-dimethyl-3-oxopropyl)-7a-fluoro-1-oxo-3a,4,6,7-tetrahydro-3H-pyrrolo[3,4-c]pyridine-5-carboxylate (PubChem CID 167108356) has the molecular formula C19H31FN2O5 and a molecular weight of 386.46 g/mol. Its IUPAC name is tert-butyl (3aR,7aR)-2-(3-ethoxy-2,2-dimethyl-3-oxopropyl)-7a-fluoro-1-oxo-3a,4,6,7-tetrahydro-3H-pyrrolo[3,4-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl (3aR,7aR)-2-(3-ethoxy-2,2-dimethyl-3-oxopropyl)-7a-fluoro-1-oxo-3a,4,6,7-tetrahydro-3H-pyrrolo[3,4-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 167108356 |
| Molecular Formula | C19H31FN2O5 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | tert-butyl (3aR,7aR)-2-(3-ethoxy-2,2-dimethyl-3-oxopropyl)-7a-fluoro-1-oxo-3a,4,6,7-tetrahydro-3H-pyrrolo[3,4-c]pyridine-5-carboxylate |
| SMILES | CCOC(=O)C(C)(C)CN1C[C@@H]2CN(C(=O)OC(C)(C)C)CC[C@]2(F)C1=O |
| InChI | InChI=1S/C19H31FN2O5/c1-7-26-15(24)18(5,6)12-22-11-13-10-21(16(25)27-17(2,3)4)9-8-19(13,20)14(22)23/h13H,7-12H2,1-6H3/t13-,19+/m0/s1 |
| InChIKey | BDLYFZRCWZHJNB-ORAYPTAESA-N |
| XLogP | 2.38 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |