C16H21ClF2N2O2 — CID 171560605
tert-butyl 4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylpiperidine-1-carboxylate (PubChem CID 171560605) has the molecular formula C16H21ClF2N2O2 and a molecular weight of 346.81 g/mol. Its IUPAC name is tert-butyl 4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 171560605 |
| Molecular Formula | C16H21ClF2N2O2 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | tert-butyl 4-(5-chloro-2-fluoro-3-pyridinyl)-4-fluoro-3-methylpiperidine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCC1(F)c1cc(Cl)cnc1F |
| InChI | InChI=1S/C16H21ClF2N2O2/c1-10-9-21(14(22)23-15(2,3)4)6-5-16(10,19)12-7-11(17)8-20-13(12)18/h7-8,10H,5-6,9H2,1-4H3 |
| InChIKey | HZQRENGQXYHPMN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|