C13H14O4 — CID 163397165
4-hydroxy-4-(hydroxymethyl)-5-(4-methoxyphenyl)cyclopent-2-en-1-one (PubChem CID 163397165) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-hydroxy-4-(hydroxymethyl)-5-(4-methoxyphenyl)cyclopent-2-en-1-one.
| Compound Name | 4-hydroxy-4-(hydroxymethyl)-5-(4-methoxyphenyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 163397165 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-hydroxy-4-(hydroxymethyl)-5-(4-methoxyphenyl)cyclopent-2-en-1-one |
| SMILES | COc1ccc(C2C(=O)C=CC2(O)CO)cc1 |
| InChI | InChI=1S/C13H14O4/c1-17-10-4-2-9(3-5-10)12-11(15)6-7-13(12,16)8-14/h2-7,12,14,16H,8H2,1H3 |
| InChIKey | MUBDYIMTZDTYSL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |