About ethyl 3-(aminomethyl)-4,5-dihydro-1,2-oxazole-5-carboxylate;hydrochloride
ethyl 3-(aminomethyl)-4,5-dihydro-1,2-oxazole-5-carboxylate;hydrochloride (PubChem CID 163398820) has the molecular formula C7H13ClN2O3
and a molecular weight of 208.64 g/mol. Its IUPAC name is ethyl 3-(aminomethyl)-4,5-dihydro-1,2-oxazole-5-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 3-(aminomethyl)-4,5-dihydro-1,2-oxazole-5-carboxylate;hydrochloride |
| PubChem CID | 163398820 |
| Molecular Formula | C7H13ClN2O3 |
| Molecular Weight | 208.64 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | ethyl 3-(aminomethyl)-4,5-dihydro-1,2-oxazole-5-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1CC(CN)=NO1.Cl |
| InChI | InChI=1S/C7H12N2O3.ClH/c1-2-11-7(10)6-3-5(4-8)9-12-6;/h6H,2-4,8H2,1H3;1H |
| InChIKey | YTNUWOHLLKMYEU-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.64 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-(aminomethyl)-4,5-dihydro-1,2-oxazole-5-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(aminomethyl)-4,5-dihydro-1,2-oxazole-5-carboxylate;hydrochloride?
The IUPAC name of ethyl 3-(aminomethyl)-4,5-dihydro-1,2-oxazole-5-carboxylate;hydrochloride (CID 163398820) is ethyl 3-(aminomethyl)-4,5-dihydro-1,2-oxazole-5-carboxylate;hydrochloride.
What is the SMILES notation for ethyl 3-(aminomethyl)-4,5-dihydro-1,2-oxazole-5-carboxylate;hydrochloride?
The canonical SMILES for ethyl 3-(aminomethyl)-4,5-dihydro-1,2-oxazole-5-carboxylate;hydrochloride is CCOC(=O)C1CC(CN)=NO1.Cl.
What is the InChIKey of ethyl 3-(aminomethyl)-4,5-dihydro-1,2-oxazole-5-carboxylate;hydrochloride?
The InChIKey is YTNUWOHLLKMYEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3.ClH/c1-2-11-7(10)6-3-5(4-8)9-12-6;/h6H,2-4,8H2,1H3;1H.
What are the key properties of ethyl 3-(aminomethyl)-4,5-dihydro-1,2-oxazole-5-carboxylate;hydrochloride?
ethyl 3-(aminomethyl)-4,5-dihydro-1,2-oxazole-5-carboxylate;hydrochloride has a molecular weight of 208.64 g/mol, XLogP of 0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(aminomethyl)-4,5-dihydro-1,2-oxazole-5-carboxylate;hydrochloride is sourced from PubChem (CID 163398820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).