C14H19N2O5PS — CID 163399387
4-(6,7-dimethoxyquinazolin-4-yl)sulfanylbutylphosphonic acid (PubChem CID 163399387) has the molecular formula C14H19N2O5PS and a molecular weight of 358.36 g/mol. Its IUPAC name is 4-(6,7-dimethoxyquinazolin-4-yl)sulfanylbutylphosphonic acid.
| Compound Name | 4-(6,7-dimethoxyquinazolin-4-yl)sulfanylbutylphosphonic acid |
|---|---|
| PubChem CID | 163399387 |
| Molecular Formula | C14H19N2O5PS |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4-(6,7-dimethoxyquinazolin-4-yl)sulfanylbutylphosphonic acid |
| SMILES | COc1cc2ncnc(SCCCCP(=O)(O)O)c2cc1OC |
| InChI | InChI=1S/C14H19N2O5PS/c1-20-12-7-10-11(8-13(12)21-2)15-9-16-14(10)23-6-4-3-5-22(17,18)19/h7-9H,3-6H2,1-2H3,(H2,17,18,19) |
| InChIKey | NQERHAUHAOURKC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|